C8H5Cl2NSe — CID 132988045
(2,6-dichlorophenyl)methyl selenocyanate (PubChem CID 132988045) has the molecular formula C8H5Cl2NSe and a molecular weight of 265.00 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl selenocyanate.
| Compound Name | (2,6-dichlorophenyl)methyl selenocyanate |
|---|---|
| PubChem CID | 132988045 |
| Molecular Formula | C8H5Cl2NSe |
| Molecular Weight | 265.00 g/mol |
| Exact Mass | 264.90 |
| IUPAC Name | (2,6-dichlorophenyl)methyl selenocyanate |
| SMILES | N#C[Se]Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H5Cl2NSe/c9-7-2-1-3-8(10)6(7)4-12-5-11/h1-3H,4H2 |
| InChIKey | RFWKGVHRSLZLDF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.00 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|