C9H10Cl2S — CID 59881902
1,3-dichloro-2-(ethylsulfanylmethyl)benzene (PubChem CID 59881902) has the molecular formula C9H10Cl2S and a molecular weight of 221.15 g/mol. Its IUPAC name is 1,3-dichloro-2-(ethylsulfanylmethyl)benzene.
| Compound Name | 1,3-dichloro-2-(ethylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 59881902 |
| Molecular Formula | C9H10Cl2S |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 1,3-dichloro-2-(ethylsulfanylmethyl)benzene |
| SMILES | CCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H10Cl2S/c1-2-12-6-7-8(10)4-3-5-9(7)11/h3-5H,2,6H2,1H3 |
| InChIKey | BCGUQOMNNNRTBM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |