C13H11BrCl2N2O — CID 71354489
1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-carboxamide bromide (PubChem CID 71354489) has the molecular formula C13H11BrCl2N2O and a molecular weight of 362.05 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-carboxamide bromide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 71354489 |
| Molecular Formula | C13H11BrCl2N2O |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]pyridin-1-ium-3-carboxamide bromide |
| SMILES | NC(=O)c1ccc[n+](Cc2c(Cl)cccc2Cl)c1.[Br-] |
| InChI | InChI=1S/C13H10Cl2N2O.BrH/c14-11-4-1-5-12(15)10(11)8-17-6-2-3-9(7-17)13(16)18;/h1-7H,8H2,(H-,16,18);1H |
| InChIKey | KDCOOBWMLCHZCP-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|