C14H13Cl2N2O+ — CID 13227261
1-[(2,6-dichlorophenyl)methyl]-6-methylpyridin-1-ium-3-carboxamide (PubChem CID 13227261) has the molecular formula C14H13Cl2N2O+ and a molecular weight of 296.18 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-6-methylpyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-6-methylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 13227261 |
| Molecular Formula | C14H13Cl2N2O+ |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-6-methylpyridin-1-ium-3-carboxamide |
| SMILES | Cc1ccc(C(N)=O)c[n+]1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O/c1-9-5-6-10(14(17)19)7-18(9)8-11-12(15)3-2-4-13(11)16/h2-7H,8H2,1H3,(H-,17,19)/p+1 |
| InChIKey | XJJOVNSTFSVUTK-UHFFFAOYSA-O |
| XLogP | 2.74 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|