C12H14ClN3O2 — CID 18205089
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 18205089) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 18205089 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | Cc1noc(C)c1C[n+]1cccc(C(N)=O)c1.[Cl-] |
| InChI | InChI=1S/C12H13N3O2.ClH/c1-8-11(9(2)17-14-8)7-15-5-3-4-10(6-15)12(13)16;/h3-6H,7H2,1-2H3,(H-,13,16);1H |
| InChIKey | CQFHZZUDRLHLJX-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 73.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|