C14H13BrN2O3 — CID 171375945
4-[(3-carbamoylpyridin-1-ium-1-yl)methyl]benzoate;hydrobromide (PubChem CID 171375945) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 4-[(3-carbamoylpyridin-1-ium-1-yl)methyl]benzoate;hydrobromide.
| Compound Name | 4-[(3-carbamoylpyridin-1-ium-1-yl)methyl]benzoate;hydrobromide |
|---|---|
| PubChem CID | 171375945 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[(3-carbamoylpyridin-1-ium-1-yl)methyl]benzoate;hydrobromide |
| SMILES | Br.NC(=O)c1ccc[n+](Cc2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C14H12N2O3.BrH/c15-13(17)12-2-1-7-16(9-12)8-10-3-5-11(6-4-10)14(18)19;/h1-7,9H,8H2,(H2-,15,17,18,19);1H |
| InChIKey | DEZOXPYINYGAEO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|