C13H12Cl2N2O — CID 47105317
1-[(3-chlorophenyl)methyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 47105317) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-[(3-chlorophenyl)methyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 47105317 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | NC(=O)c1ccc[n+](Cc2cccc(Cl)c2)c1.[Cl-] |
| InChI | InChI=1S/C13H11ClN2O.ClH/c14-12-5-1-3-10(7-12)8-16-6-2-4-11(9-16)13(15)17;/h1-7,9H,8H2,(H-,15,17);1H |
| InChIKey | JHYPGNHKGCUFSN-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|