C14H14N3O2+ — CID 23252069
1-benzylpyridin-1-ium-3,5-dicarboxamide (PubChem CID 23252069) has the molecular formula C14H14N3O2+ and a molecular weight of 256.29 g/mol. Its IUPAC name is 1-benzylpyridin-1-ium-3,5-dicarboxamide.
| Compound Name | 1-benzylpyridin-1-ium-3,5-dicarboxamide |
|---|---|
| PubChem CID | 23252069 |
| Molecular Formula | C14H14N3O2+ |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-benzylpyridin-1-ium-3,5-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)c[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C14H13N3O2/c15-13(18)11-6-12(14(16)19)9-17(8-11)7-10-4-2-1-3-5-10/h1-6,8-9H,7H2,(H3-,15,16,18,19)/p+1 |
| InChIKey | NWYCFIITMFEEKP-UHFFFAOYSA-O |
| XLogP | 0.22 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|