C14H13BrFN3O2 — CID 139224702
1-[(4-fluorophenyl)methyl]pyridin-1-ium-3,5-dicarboxamide bromide (PubChem CID 139224702) has the molecular formula C14H13BrFN3O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]pyridin-1-ium-3,5-dicarboxamide bromide.
| Compound Name | 1-[(4-fluorophenyl)methyl]pyridin-1-ium-3,5-dicarboxamide bromide |
|---|---|
| PubChem CID | 139224702 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]pyridin-1-ium-3,5-dicarboxamide bromide |
| SMILES | NC(=O)c1cc(C(N)=O)c[n+](Cc2ccc(F)cc2)c1.[Br-] |
| InChI | InChI=1S/C14H12FN3O2.BrH/c15-12-3-1-9(2-4-12)6-18-7-10(13(16)19)5-11(8-18)14(17)20;/h1-5,7-8H,6H2,(H3-,16,17,19,20);1H |
| InChIKey | PNEYMGQKCACGCX-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|