C15H13BrF3N3O2 — CID 139224700
1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3,5-dicarboxamide bromide (PubChem CID 139224700) has the molecular formula C15H13BrF3N3O2 and a molecular weight of 404.19 g/mol. Its IUPAC name is 1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3,5-dicarboxamide bromide.
| Compound Name | 1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3,5-dicarboxamide bromide |
|---|---|
| PubChem CID | 139224700 |
| Molecular Formula | C15H13BrF3N3O2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-1-ium-3,5-dicarboxamide bromide |
| SMILES | NC(=O)c1cc(C(N)=O)c[n+](Cc2ccc(C(F)(F)F)cc2)c1.[Br-] |
| InChI | InChI=1S/C15H12F3N3O2.BrH/c16-15(17,18)12-3-1-9(2-4-12)6-21-7-10(13(19)22)5-11(8-21)14(20)23;/h1-5,7-8H,6H2,(H3-,19,20,22,23);1H |
| InChIKey | GTEIZDRABVSTRT-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|