C15H16N3O2+ — CID 139224697
1-[(4-methylphenyl)methyl]pyridin-1-ium-3,5-dicarboxamide (PubChem CID 139224697) has the molecular formula C15H16N3O2+ and a molecular weight of 270.31 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]pyridin-1-ium-3,5-dicarboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]pyridin-1-ium-3,5-dicarboxamide |
|---|---|
| PubChem CID | 139224697 |
| Molecular Formula | C15H16N3O2+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]pyridin-1-ium-3,5-dicarboxamide |
| SMILES | Cc1ccc(C[n+]2cc(C(N)=O)cc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-2-4-11(5-3-10)7-18-8-12(14(16)19)6-13(9-18)15(17)20/h2-6,8-9H,7H2,1H3,(H3-,16,17,19,20)/p+1 |
| InChIKey | VXCZCVDUGKODBM-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|