C16H18N3O2+ — CID 23252068
1-benzyl-3-N,5-N-dimethylpyridin-1-ium-3,5-dicarboxamide (PubChem CID 23252068) has the molecular formula C16H18N3O2+ and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-benzyl-3-N,5-N-dimethylpyridin-1-ium-3,5-dicarboxamide.
| Compound Name | 1-benzyl-3-N,5-N-dimethylpyridin-1-ium-3,5-dicarboxamide |
|---|---|
| PubChem CID | 23252068 |
| Molecular Formula | C16H18N3O2+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-benzyl-3-N,5-N-dimethylpyridin-1-ium-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC)c[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H17N3O2/c1-17-15(20)13-8-14(16(21)18-2)11-19(10-13)9-12-6-4-3-5-7-12/h3-8,10-11H,9H2,1-2H3,(H-,17,18,20,21)/p+1 |
| InChIKey | XOENPDWYEGHYAQ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|