C15H15ClN2O — CID 71402314
1-[(2-ethenylphenyl)methyl]pyridin-1-ium-3-carboxamide chloride (PubChem CID 71402314) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-[(2-ethenylphenyl)methyl]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-[(2-ethenylphenyl)methyl]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 71402314 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[(2-ethenylphenyl)methyl]pyridin-1-ium-3-carboxamide chloride |
| SMILES | C=Cc1ccccc1C[n+]1cccc(C(N)=O)c1.[Cl-] |
| InChI | InChI=1S/C15H14N2O.ClH/c1-2-12-6-3-4-7-13(12)10-17-9-5-8-14(11-17)15(16)18;/h2-9,11H,1,10H2,(H-,16,18);1H |
| InChIKey | NRXHKBWDUQHDPD-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|