C15H14N3O5+ — CID 8831805
1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium-3-carboxamide (PubChem CID 8831805) has the molecular formula C15H14N3O5+ and a molecular weight of 316.29 g/mol. Its IUPAC name is 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8831805 |
| Molecular Formula | C15H14N3O5+ |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](Cc2cc([N+](=O)[O-])cc3c2OCOC3)c1 |
| InChI | InChI=1S/C15H13N3O5/c16-15(19)10-2-1-3-17(6-10)7-11-4-13(18(20)21)5-12-8-22-9-23-14(11)12/h1-6H,7-9H2,(H-,16,19)/p+1 |
| InChIKey | QCFAZUKUGKOVGW-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|