C15H16N3O5S+ — CID 88773595
2-amino-1-[3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]phenyl]-2-oxoethanesulfonic acid (PubChem CID 88773595) has the molecular formula C15H16N3O5S+ and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-amino-1-[3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]phenyl]-2-oxoethanesulfonic acid.
| Compound Name | 2-amino-1-[3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]phenyl]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88773595 |
| Molecular Formula | C15H16N3O5S+ |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-amino-1-[3-[(4-carbamoylpyridin-1-ium-1-yl)methyl]phenyl]-2-oxoethanesulfonic acid |
| SMILES | NC(=O)c1cc[n+](Cc2cccc(C(C(N)=O)S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H15N3O5S/c16-14(19)11-4-6-18(7-5-11)9-10-2-1-3-12(8-10)13(15(17)20)24(21,22)23/h1-8,13H,9H2,(H4-,16,17,19,20,21,22,23)/p+1 |
| InChIKey | LHXXPVQRDZPHCZ-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|