C21H26NO3+ — CID 134419208
[(2R)-3,3-dimethylbutan-2-yl] 3-[(4-acetylpyridin-1-ium-1-yl)methyl]benzoate (PubChem CID 134419208) has the molecular formula C21H26NO3+ and a molecular weight of 340.44 g/mol. Its IUPAC name is [(2R)-3,3-dimethylbutan-2-yl] 3-[(4-acetylpyridin-1-ium-1-yl)methyl]benzoate.
| Compound Name | [(2R)-3,3-dimethylbutan-2-yl] 3-[(4-acetylpyridin-1-ium-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 134419208 |
| Molecular Formula | C21H26NO3+ |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(2R)-3,3-dimethylbutan-2-yl] 3-[(4-acetylpyridin-1-ium-1-yl)methyl]benzoate |
| SMILES | CC(=O)c1cc[n+](Cc2cccc(C(=O)O[C@H](C)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C21H26NO3/c1-15(23)18-9-11-22(12-10-18)14-17-7-6-8-19(13-17)20(24)25-16(2)21(3,4)5/h6-13,16H,14H2,1-5H3/q+1/t16-/m1/s1 |
| InChIKey | KNXVKNFXGGFURW-MRXNPFEDSA-N |
| XLogP | 3.82 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|