About butan-2-yl 3-(aminomethyl)benzoate
butan-2-yl 3-(aminomethyl)benzoate (PubChem CID 60903488) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is butan-2-yl 3-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | butan-2-yl 3-(aminomethyl)benzoate |
| PubChem CID | 60903488 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | butan-2-yl 3-(aminomethyl)benzoate |
| SMILES | CCC(C)OC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C12H17NO2/c1-3-9(2)15-12(14)11-6-4-5-10(7-11)8-13/h4-7,9H,3,8,13H2,1-2H3 |
| InChIKey | WIENEVXPOGAERV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-2-yl 3-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 3-(aminomethyl)benzoate?
The IUPAC name of butan-2-yl 3-(aminomethyl)benzoate (CID 60903488) is butan-2-yl 3-(aminomethyl)benzoate.
What is the SMILES notation for butan-2-yl 3-(aminomethyl)benzoate?
The canonical SMILES for butan-2-yl 3-(aminomethyl)benzoate is CCC(C)OC(=O)c1cccc(CN)c1.
What is the InChIKey of butan-2-yl 3-(aminomethyl)benzoate?
The InChIKey is WIENEVXPOGAERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-9(2)15-12(14)11-6-4-5-10(7-11)8-13/h4-7,9H,3,8,13H2,1-2H3.
What are the key properties of butan-2-yl 3-(aminomethyl)benzoate?
butan-2-yl 3-(aminomethyl)benzoate has a molecular weight of 207.27 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 3-(aminomethyl)benzoate is sourced from PubChem (CID 60903488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).