About ethane;propan-2-yl 3-(chloromethyl)benzoate
ethane;propan-2-yl 3-(chloromethyl)benzoate (PubChem CID 145065930) has the molecular formula C13H19ClO2
and a molecular weight of 242.75 g/mol. Its IUPAC name is ethane;propan-2-yl 3-(chloromethyl)benzoate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 3-(chloromethyl)benzoate |
| PubChem CID | 145065930 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethane;propan-2-yl 3-(chloromethyl)benzoate |
| SMILES | CC.CC(C)OC(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C11H13ClO2.C2H6/c1-8(2)14-11(13)10-5-3-4-9(6-10)7-12;1-2/h3-6,8H,7H2,1-2H3;1-2H3 |
| InChIKey | OIHWOMAOGCEROC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;propan-2-yl 3-(chloromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 3-(chloromethyl)benzoate?
The IUPAC name of ethane;propan-2-yl 3-(chloromethyl)benzoate (CID 145065930) is ethane;propan-2-yl 3-(chloromethyl)benzoate.
What is the SMILES notation for ethane;propan-2-yl 3-(chloromethyl)benzoate?
The canonical SMILES for ethane;propan-2-yl 3-(chloromethyl)benzoate is CC.CC(C)OC(=O)c1cccc(CCl)c1.
What is the InChIKey of ethane;propan-2-yl 3-(chloromethyl)benzoate?
The InChIKey is OIHWOMAOGCEROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO2.C2H6/c1-8(2)14-11(13)10-5-3-4-9(6-10)7-12;1-2/h3-6,8H,7H2,1-2H3;1-2H3.
What are the key properties of ethane;propan-2-yl 3-(chloromethyl)benzoate?
ethane;propan-2-yl 3-(chloromethyl)benzoate has a molecular weight of 242.75 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 3-(chloromethyl)benzoate is sourced from PubChem (CID 145065930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).