About 3-(chloromethyl)benzoate chloride
3-(chloromethyl)benzoate chloride (PubChem CID 22464899) has the molecular formula C8H6Cl2O2-2
and a molecular weight of 205.04 g/mol. Its IUPAC name is 3-(chloromethyl)benzoate chloride.
Molecular Properties
| Compound Name | 3-(chloromethyl)benzoate chloride |
| PubChem CID | 22464899 |
| Molecular Formula | C8H6Cl2O2-2 |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | 3-(chloromethyl)benzoate chloride |
| SMILES | O=C([O-])c1cccc(CCl)c1.[Cl-] |
| InChI | InChI=1S/C8H7ClO2.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;/h1-4H,5H2,(H,10,11);1H/p-2 |
| InChIKey | ZPFIBBPPTYPEMI-UHFFFAOYSA-L |
| XLogP | -2.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)benzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)benzoate chloride?
The IUPAC name of 3-(chloromethyl)benzoate chloride (CID 22464899) is 3-(chloromethyl)benzoate chloride.
What is the SMILES notation for 3-(chloromethyl)benzoate chloride?
The canonical SMILES for 3-(chloromethyl)benzoate chloride is O=C([O-])c1cccc(CCl)c1.[Cl-].
What is the InChIKey of 3-(chloromethyl)benzoate chloride?
The InChIKey is ZPFIBBPPTYPEMI-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H7ClO2.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;/h1-4H,5H2,(H,10,11);1H/p-2.
What are the key properties of 3-(chloromethyl)benzoate chloride?
3-(chloromethyl)benzoate chloride has a molecular weight of 205.04 g/mol, XLogP of -2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)benzoate chloride is sourced from PubChem (CID 22464899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).