C14H8Cl3O3- — CID 7015973
3-[(2,4,6-trichlorophenoxy)methyl]benzoate (PubChem CID 7015973) has the molecular formula C14H8Cl3O3- and a molecular weight of 330.57 g/mol. Its IUPAC name is 3-[(2,4,6-trichlorophenoxy)methyl]benzoate.
| Compound Name | 3-[(2,4,6-trichlorophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 7015973 |
| Molecular Formula | C14H8Cl3O3- |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 3-[(2,4,6-trichlorophenoxy)methyl]benzoate |
| SMILES | O=C([O-])c1cccc(COc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H9Cl3O3/c15-10-5-11(16)13(12(17)6-10)20-7-8-2-1-3-9(4-8)14(18)19/h1-6H,7H2,(H,18,19)/p-1 |
| InChIKey | BDVPMGPZTOMHBM-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |