C10H14ClN3O2 — CID 126475818
2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]-N,N-dimethylacetamide chloride (PubChem CID 126475818) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]-N,N-dimethylacetamide chloride.
| Compound Name | 2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]-N,N-dimethylacetamide chloride |
|---|---|
| PubChem CID | 126475818 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]-N,N-dimethylacetamide chloride |
| SMILES | CN(C)C(=O)C[n+]1cccc(/C=N/O)c1.[Cl-] |
| InChI | InChI=1S/C10H13N3O2.ClH/c1-12(2)10(14)8-13-5-3-4-9(7-13)6-11-15;/h3-7H,8H2,1-2H3;1H/b11-6+; |
| InChIKey | RFQIXSOKJWGTQG-ICSBZGNSSA-N |
| XLogP | -3.13 |
| TPSA | 56.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|