C20H26Br2N4O2 — CID 10459128
N-cyclopentyl-1-[3-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-carboxamide dibromide (PubChem CID 10459128) has the molecular formula C20H26Br2N4O2 and a molecular weight of 514.26 g/mol. Its IUPAC name is N-cyclopentyl-1-[3-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-carboxamide dibromide.
| Compound Name | N-cyclopentyl-1-[3-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-carboxamide dibromide |
|---|---|
| PubChem CID | 10459128 |
| Molecular Formula | C20H26Br2N4O2 |
| Molecular Weight | 514.26 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | N-cyclopentyl-1-[3-[3-[(E)-hydroxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-carboxamide dibromide |
| SMILES | O=C(NC1CCCC1)c1ccc[n+](CCC[n+]2cccc(/C=N/O)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C20H24N4O2.2BrH/c25-20(22-19-8-1-2-9-19)18-7-4-11-24(16-18)13-5-12-23-10-3-6-17(15-23)14-21-26;;/h3-4,6-7,10-11,14-16,19H,1-2,5,8-9,12-13H2;2*1H/b21-14+;; |
| InChIKey | DOQAFNNQEUESBO-NZYGGCLTSA-N |
| XLogP | -4.16 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.26 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|