C8H11N2O3+ — CID 87875567
N-hydroxy-1-(2-hydroxyethyl)pyridin-1-ium-3-carboxamide (PubChem CID 87875567) has the molecular formula C8H11N2O3+ and a molecular weight of 183.19 g/mol. Its IUPAC name is N-hydroxy-1-(2-hydroxyethyl)pyridin-1-ium-3-carboxamide.
| Compound Name | N-hydroxy-1-(2-hydroxyethyl)pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 87875567 |
| Molecular Formula | C8H11N2O3+ |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N-hydroxy-1-(2-hydroxyethyl)pyridin-1-ium-3-carboxamide |
| SMILES | O=C(NO)c1ccc[n+](CCO)c1 |
| InChI | InChI=1S/C8H10N2O3/c11-5-4-10-3-1-2-7(6-10)8(12)9-13/h1-3,6,11H,4-5H2,(H-,9,12,13)/p+1 |
| InChIKey | VQGWLVSHOIHABP-UHFFFAOYSA-O |
| XLogP | -0.91 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|