C11H14N3O3+ — CID 59223376
N-(2-amino-2-oxoethyl)-1-(2-oxopropyl)pyridin-1-ium-3-carboxamide (PubChem CID 59223376) has the molecular formula C11H14N3O3+ and a molecular weight of 236.25 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-1-(2-oxopropyl)pyridin-1-ium-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-1-(2-oxopropyl)pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 59223376 |
| Molecular Formula | C11H14N3O3+ |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-1-(2-oxopropyl)pyridin-1-ium-3-carboxamide |
| SMILES | CC(=O)C[n+]1cccc(C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C11H13N3O3/c1-8(15)6-14-4-2-3-9(7-14)11(17)13-5-10(12)16/h2-4,7H,5-6H2,1H3,(H2-,12,13,16,17)/p+1 |
| InChIKey | ZDHPZLJFOODMKR-UHFFFAOYSA-O |
| XLogP | -1.22 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|