C9H9IN2O2 — CID 89417127
N-(2-amino-2-oxoethyl)-3-(125I)iodo(125I)benzamide (PubChem CID 89417127) has the molecular formula C9H9IN2O2 and a molecular weight of 302.09 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(125I)iodo(125I)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(125I)iodo(125I)benzamide |
|---|---|
| PubChem CID | 89417127 |
| Molecular Formula | C9H9IN2O2 |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(125I)iodo(125I)benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc([125I])c1 |
| InChI | InChI=1S/C9H9IN2O2/c10-7-3-1-2-6(4-7)9(14)12-5-8(11)13/h1-4H,5H2,(H2,11,13)(H,12,14)/i10-2 |
| InChIKey | POUAVMDZTXOBDG-CKWBHOIGSA-N |
| XLogP | 0.51 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|