C9H11N3O2 — CID 16775093
3-amino-N-(2-amino-2-oxoethyl)benzamide (PubChem CID 16775093) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)benzamide.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 16775093 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C9H11N3O2/c10-7-3-1-2-6(4-7)9(14)12-5-8(11)13/h1-4H,5,10H2,(H2,11,13)(H,12,14) |
| InChIKey | BSPBJCYXCMMGBA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|