C10H14N4O2S — CID 140989186
N-(2-amino-2-oxoethyl)-3-(aminosulfanylmethylamino)benzamide (PubChem CID 140989186) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(aminosulfanylmethylamino)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(aminosulfanylmethylamino)benzamide |
|---|---|
| PubChem CID | 140989186 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(aminosulfanylmethylamino)benzamide |
| SMILES | NSCNc1cccc(C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C10H14N4O2S/c11-9(15)5-13-10(16)7-2-1-3-8(4-7)14-6-17-12/h1-4,14H,5-6,12H2,(H2,11,15)(H,13,16) |
| InChIKey | STWLJRBRSYHABD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|