C18H25N3O2 — CID 97157129
N-(2-amino-2-oxoethyl)-3-[[(1R,3S)-3-cyclopropylcyclohexyl]amino]benzamide (PubChem CID 97157129) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-[[(1R,3S)-3-cyclopropylcyclohexyl]amino]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-[[(1R,3S)-3-cyclopropylcyclohexyl]amino]benzamide |
|---|---|
| PubChem CID | 97157129 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-[[(1R,3S)-3-cyclopropylcyclohexyl]amino]benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc(N[C@@H]2CCC[C@H](C3CC3)C2)c1 |
| InChI | InChI=1S/C18H25N3O2/c19-17(22)11-20-18(23)14-4-2-6-16(10-14)21-15-5-1-3-13(9-15)12-7-8-12/h2,4,6,10,12-13,15,21H,1,3,5,7-9,11H2,(H2,19,22)(H,20,23)/t13-,15+/m0/s1 |
| InChIKey | HIFYFKVVFSIZPK-DZGCQCFKSA-N |
| XLogP | 2.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |