C16H22N4O3 — CID 119284430
3-[(1-aminocyclohexanecarbonyl)amino]-N-(2-amino-2-oxoethyl)benzamide (PubChem CID 119284430) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[(1-aminocyclohexanecarbonyl)amino]-N-(2-amino-2-oxoethyl)benzamide.
| Compound Name | 3-[(1-aminocyclohexanecarbonyl)amino]-N-(2-amino-2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 119284430 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[(1-aminocyclohexanecarbonyl)amino]-N-(2-amino-2-oxoethyl)benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc(NC(=O)C2(N)CCCCC2)c1 |
| InChI | InChI=1S/C16H22N4O3/c17-13(21)10-19-14(22)11-5-4-6-12(9-11)20-15(23)16(18)7-2-1-3-8-16/h4-6,9H,1-3,7-8,10,18H2,(H2,17,21)(H,19,22)(H,20,23) |
| InChIKey | SQLLQMQFZUVURO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |