C16H18ClN3O3 — CID 126460344
1-(2-hydroxyethyl)-N-[(E)-(4-methoxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride (PubChem CID 126460344) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-[(E)-(4-methoxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-(2-hydroxyethyl)-N-[(E)-(4-methoxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 126460344 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-[(E)-(4-methoxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc[n+](CCO)c2)cc1.[Cl-] |
| InChI | InChI=1S/C16H17N3O3.ClH/c1-22-15-6-4-13(5-7-15)11-17-18-16(21)14-3-2-8-19(12-14)9-10-20;/h2-8,11-12,20H,9-10H2,1H3;1H/b17-11+; |
| InChIKey | BMXVSBOZJBDCTK-SJDTYFKWSA-N |
| XLogP | -2.26 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|