C20H18ClN3O2 — CID 136632835
1-benzyl-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride (PubChem CID 136632835) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-benzyl-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride.
| Compound Name | 1-benzyl-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 136632835 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-benzyl-N-[(E)-(4-hydroxyphenyl)methylideneamino]pyridin-1-ium-3-carboxamide chloride |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)c1ccc[n+](Cc2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C20H17N3O2.ClH/c24-19-10-8-16(9-11-19)13-21-22-20(25)18-7-4-12-23(15-18)14-17-5-2-1-3-6-17;/h1-13,15H,14H2,(H-,21,22,24,25);1H |
| InChIKey | WYQBGWDRFACADX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 65.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|