C24H34N2+2 — CID 24742483
3-methyl-1-[(5Z,7Z)-12-(3-methylpyridin-1-ium-1-yl)dodeca-5,7-dienyl]pyridin-1-ium (PubChem CID 24742483) has the molecular formula C24H34N2+2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 3-methyl-1-[(5Z,7Z)-12-(3-methylpyridin-1-ium-1-yl)dodeca-5,7-dienyl]pyridin-1-ium.
| Compound Name | 3-methyl-1-[(5Z,7Z)-12-(3-methylpyridin-1-ium-1-yl)dodeca-5,7-dienyl]pyridin-1-ium |
|---|---|
| PubChem CID | 24742483 |
| Molecular Formula | C24H34N2+2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 3-methyl-1-[(5Z,7Z)-12-(3-methylpyridin-1-ium-1-yl)dodeca-5,7-dienyl]pyridin-1-ium |
| SMILES | Cc1ccc[n+](CCCC/C=C\C=C/CCCC[n+]2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H34N2/c1-23-15-13-19-25(21-23)17-11-9-7-5-3-4-6-8-10-12-18-26-20-14-16-24(2)22-26/h3-6,13-16,19-22H,7-12,17-18H2,1-2H3/q+2/b5-3-,6-4- |
| InChIKey | MPQLLNRPVVWSQZ-GLIMQPGKSA-N |
| XLogP | 5.03 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|