C40H54Br2N2+2 — CID 162166824
1,4-bis(4-bromobutyl)benzene;3-methyl-1-[4-[4-[4-(3-methylpyridin-1-ium-1-yl)butyl]phenyl]butyl]pyridin-1-ium (PubChem CID 162166824) has the molecular formula C40H54Br2N2+2 and a molecular weight of 722.69 g/mol. Its IUPAC name is 1,4-bis(4-bromobutyl)benzene;3-methyl-1-[4-[4-[4-(3-methylpyridin-1-ium-1-yl)butyl]phenyl]butyl]pyridin-1-ium.
| Compound Name | 1,4-bis(4-bromobutyl)benzene;3-methyl-1-[4-[4-[4-(3-methylpyridin-1-ium-1-yl)butyl]phenyl]butyl]pyridin-1-ium |
|---|---|
| PubChem CID | 162166824 |
| Molecular Formula | C40H54Br2N2+2 |
| Molecular Weight | 722.69 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | 1,4-bis(4-bromobutyl)benzene;3-methyl-1-[4-[4-[4-(3-methylpyridin-1-ium-1-yl)butyl]phenyl]butyl]pyridin-1-ium |
| SMILES | BrCCCCc1ccc(CCCCBr)cc1.Cc1ccc[n+](CCCCc2ccc(CCCC[n+]3cccc(C)c3)cc2)c1 |
| InChI | InChI=1S/C26H34N2.C14H20Br2/c1-23-9-7-19-27(21-23)17-5-3-11-25-13-15-26(16-14-25)12-4-6-18-28-20-8-10-24(2)22-28;15-11-3-1-5-13-7-9-14(10-8-13)6-2-4-12-16/h7-10,13-16,19-22H,3-6,11-12,17-18H2,1-2H3;7-10H,1-6,11-12H2/q+2; |
| InChIKey | ZNFZGZJGXRXQGS-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.69 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|