C60H79Br3N3+3 — CID 159525217
1-[5-[3,5-bis[5-(3-methylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pentyl]-3-methylpyridin-1-ium;1,3,5-tris(5-bromopentyl)benzene (PubChem CID 159525217) has the molecular formula C60H79Br3N3+3 and a molecular weight of 1082.02 g/mol. Its IUPAC name is 1-[5-[3,5-bis[5-(3-methylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pentyl]-3-methylpyridin-1-ium;1,3,5-tris(5-bromopentyl)benzene.
| Compound Name | 1-[5-[3,5-bis[5-(3-methylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pentyl]-3-methylpyridin-1-ium;1,3,5-tris(5-bromopentyl)benzene |
|---|---|
| PubChem CID | 159525217 |
| Molecular Formula | C60H79Br3N3+3 |
| Molecular Weight | 1082.02 g/mol |
| Exact Mass | 1078.38 |
| IUPAC Name | 1-[5-[3,5-bis[5-(3-methylpyridin-1-ium-1-yl)pent-1-ynyl]phenyl]pentyl]-3-methylpyridin-1-ium;1,3,5-tris(5-bromopentyl)benzene |
| SMILES | BrCCCCCc1cc(CCCCCBr)cc(CCCCCBr)c1.Cc1ccc[n+](CCCC#Cc2cc(C#CCCC[n+]3cccc(C)c3)cc(CCCCC[n+]3cccc(C)c3)c2)c1 |
| InChI | InChI=1S/C39H46N3.C21H33Br3/c1-34-16-13-25-40(31-34)22-10-4-7-19-37-28-38(20-8-5-11-23-41-26-14-17-35(2)32-41)30-39(29-37)21-9-6-12-24-42-27-15-18-36(3)33-42;22-13-7-1-4-10-19-16-20(11-5-2-8-14-23)18-21(17-19)12-6-3-9-15-24/h13-18,25-33H,4-7,10-12,19,22-24H2,1-3H3;16-18H,1-15H2/q+3; |
| InChIKey | MCHKMBZPRKSVSD-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.02 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|