C42H42Br2N2+2 — CID 157076913
1,3-bis(5-bromopent-1-ynyl)benzene;1-[5-[3-(5-pyridin-1-ium-1-ylpent-1-ynyl)phenyl]pent-4-ynyl]pyridin-1-ium (PubChem CID 157076913) has the molecular formula C42H42Br2N2+2 and a molecular weight of 734.62 g/mol. Its IUPAC name is 1,3-bis(5-bromopent-1-ynyl)benzene;1-[5-[3-(5-pyridin-1-ium-1-ylpent-1-ynyl)phenyl]pent-4-ynyl]pyridin-1-ium.
| Compound Name | 1,3-bis(5-bromopent-1-ynyl)benzene;1-[5-[3-(5-pyridin-1-ium-1-ylpent-1-ynyl)phenyl]pent-4-ynyl]pyridin-1-ium |
|---|---|
| PubChem CID | 157076913 |
| Molecular Formula | C42H42Br2N2+2 |
| Molecular Weight | 734.62 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | 1,3-bis(5-bromopent-1-ynyl)benzene;1-[5-[3-(5-pyridin-1-ium-1-ylpent-1-ynyl)phenyl]pent-4-ynyl]pyridin-1-ium |
| SMILES | BrCCCC#Cc1cccc(C#CCCCBr)c1.C(#Cc1cccc(C#CCCC[n+]2ccccc2)c1)CCC[n+]1ccccc1 |
| InChI | InChI=1S/C26H26N2.C16H16Br2/c1(7-18-27-20-9-3-10-21-27)5-14-25-16-13-17-26(24-25)15-6-2-8-19-28-22-11-4-12-23-28;17-12-5-1-3-8-15-10-7-11-16(14-15)9-4-2-6-13-18/h3-4,9-13,16-17,20-24H,1-2,7-8,18-19H2;7,10-11,14H,1-2,5-6,12-13H2/q+2; |
| InChIKey | ADBPVLXQRMLMRQ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.62 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|