C36H44N4+2 — CID 59243246
3-[(2R)-1-methylpyrrolidin-2-yl]-1-[5-[3-[5-[3-[(2R)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium (PubChem CID 59243246) has the molecular formula C36H44N4+2 and a molecular weight of 532.78 g/mol. Its IUPAC name is 3-[(2R)-1-methylpyrrolidin-2-yl]-1-[5-[3-[5-[3-[(2R)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium.
| Compound Name | 3-[(2R)-1-methylpyrrolidin-2-yl]-1-[5-[3-[5-[3-[(2R)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium |
|---|---|
| PubChem CID | 59243246 |
| Molecular Formula | C36H44N4+2 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 3-[(2R)-1-methylpyrrolidin-2-yl]-1-[5-[3-[5-[3-[(2R)-1-methylpyrrolidin-2-yl]pyridin-1-ium-1-yl]pent-1-ynyl]phenyl]pent-4-ynyl]pyridin-1-ium |
| SMILES | CN1CCC[C@@H]1c1ccc[n+](CCCC#Cc2cccc(C#CCCC[n+]3cccc([C@H]4CCCN4C)c3)c2)c1 |
| InChI | InChI=1S/C36H44N4/c1-37-22-12-20-35(37)33-18-10-26-39(29-33)24-7-3-5-14-31-16-9-17-32(28-31)15-6-4-8-25-40-27-11-19-34(30-40)36-21-13-23-38(36)2/h9-11,16-19,26-30,35-36H,3-4,7-8,12-13,20-25H2,1-2H3/q+2/t35-,36-/m1/s1 |
| InChIKey | BWVXWRKDHWWLDO-LQFQNGICSA-N |
| XLogP | 5.46 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|