C21H40N2+2 — CID 11217194
10-(3,5-dimethylpyridin-1-ium-1-yl)decyl-ethyl-dimethylazanium (PubChem CID 11217194) has the molecular formula C21H40N2+2 and a molecular weight of 320.56 g/mol. Its IUPAC name is 10-(3,5-dimethylpyridin-1-ium-1-yl)decyl-ethyl-dimethylazanium.
| Compound Name | 10-(3,5-dimethylpyridin-1-ium-1-yl)decyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 11217194 |
| Molecular Formula | C21H40N2+2 |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | 10-(3,5-dimethylpyridin-1-ium-1-yl)decyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCCCCCCCCC[n+]1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H40N2/c1-6-23(4,5)16-14-12-10-8-7-9-11-13-15-22-18-20(2)17-21(3)19-22/h17-19H,6-16H2,1-5H3/q+2 |
| InChIKey | MKLXFTGGWZTXBO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|