C7H9F6NO5S2 — CID 163668861
2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N-methylsulfonylacetamide (PubChem CID 163668861) has the molecular formula C7H9F6NO5S2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N-methylsulfonylacetamide.
| Compound Name | 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 163668861 |
| Molecular Formula | C7H9F6NO5S2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N-methylsulfonylacetamide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C7H9F6NO5S2/c1-5(8,9)6(10,11)7(12,13)21(18,19)3-4(15)14-20(2,16)17/h3H2,1-2H3,(H,14,15) |
| InChIKey | XPMAAPNFGPPGAG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|