C7H15NO4S — CID 58895987
2-[(2-methylpropan-2-yl)oxy]-N-methylsulfonylacetamide (PubChem CID 58895987) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-N-methylsulfonylacetamide.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 58895987 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-N-methylsulfonylacetamide |
| SMILES | CC(C)(C)OCC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C7H15NO4S/c1-7(2,3)12-5-6(9)8-13(4,10)11/h5H2,1-4H3,(H,8,9) |
| InChIKey | SFDMZMZDECUUIX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |