C9H20N2O4S — CID 134195371
1-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-methylsulfonylurea (PubChem CID 134195371) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-methylsulfonylurea.
| Compound Name | 1-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-methylsulfonylurea |
|---|---|
| PubChem CID | 134195371 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[3-[(2-methylpropan-2-yl)oxy]propyl]-3-methylsulfonylurea |
| SMILES | CC(C)(C)OCCCNC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C9H20N2O4S/c1-9(2,3)15-7-5-6-10-8(12)11-16(4,13)14/h5-7H2,1-4H3,(H2,10,11,12) |
| InChIKey | VNVHQQLSMMUSKS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|