C16H31NO3 — CID 126707815
6-[(2-methylpropan-2-yl)oxy]-N-(6-oxohexyl)hexanamide (PubChem CID 126707815) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxy]-N-(6-oxohexyl)hexanamide.
| Compound Name | 6-[(2-methylpropan-2-yl)oxy]-N-(6-oxohexyl)hexanamide |
|---|---|
| PubChem CID | 126707815 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxy]-N-(6-oxohexyl)hexanamide |
| SMILES | CC(C)(C)OCCCCCC(=O)NCCCCCC=O |
| InChI | InChI=1S/C16H31NO3/c1-16(2,3)20-14-10-6-7-11-15(19)17-12-8-4-5-9-13-18/h13H,4-12,14H2,1-3H3,(H,17,19) |
| InChIKey | ADKRYPZFZPTCAI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|