C15H20F6O2S — CID 58122744
1-(1,1,2,2,3,3-hexafluorobutylsulfonylmethyl)adamantane (PubChem CID 58122744) has the molecular formula C15H20F6O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluorobutylsulfonylmethyl)adamantane.
| Compound Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonylmethyl)adamantane |
|---|---|
| PubChem CID | 58122744 |
| Molecular Formula | C15H20F6O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonylmethyl)adamantane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20F6O2S/c1-12(16,17)14(18,19)15(20,21)24(22,23)8-13-5-9-2-10(6-13)4-11(3-9)7-13/h9-11H,2-8H2,1H3 |
| InChIKey | UFNAUGHBTBWARQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|