C25H35F6NO5S2 — CID 58122724
3-[bis(1-adamantylmethyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58122724) has the molecular formula C25H35F6NO5S2 and a molecular weight of 607.68 g/mol. Its IUPAC name is 3-[bis(1-adamantylmethyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[bis(1-adamantylmethyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58122724 |
| Molecular Formula | C25H35F6NO5S2 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 3-[bis(1-adamantylmethyl)sulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N(CC12CC3CC(CC(C3)C1)C2)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H35F6NO5S2/c26-23(27,25(30,31)39(35,36)37)24(28,29)38(33,34)32(13-21-7-15-1-16(8-21)3-17(2-15)9-21)14-22-10-18-4-19(11-22)6-20(5-18)12-22/h15-20H,1-14H2,(H,35,36,37) |
| InChIKey | BETZDHWTDDZJIF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|