C15H23FO5S — CID 139293242
2-(1-adamantyl)-1-fluoro-1-propanoyloxyethanesulfonic acid (PubChem CID 139293242) has the molecular formula C15H23FO5S and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-fluoro-1-propanoyloxyethanesulfonic acid.
| Compound Name | 2-(1-adamantyl)-1-fluoro-1-propanoyloxyethanesulfonic acid |
|---|---|
| PubChem CID | 139293242 |
| Molecular Formula | C15H23FO5S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-(1-adamantyl)-1-fluoro-1-propanoyloxyethanesulfonic acid |
| SMILES | CCC(=O)OC(F)(CC12CC3CC(CC(C3)C1)C2)S(=O)(=O)O |
| InChI | InChI=1S/C15H23FO5S/c1-2-13(17)21-15(16,22(18,19)20)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,2-9H2,1H3,(H,18,19,20) |
| InChIKey | KXOQPQJAKLOWEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|