C13H22F2O3S — CID 123299076
2-(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)-1,1-difluoroethanesulfonic acid (PubChem CID 123299076) has the molecular formula C13H22F2O3S and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 123299076 |
| Molecular Formula | C13H22F2O3S |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)-1,1-difluoroethanesulfonic acid |
| SMILES | CC1CC(C)CC2(CC(F)(F)S(=O)(=O)O)CC(C1)C2 |
| InChI | InChI=1S/C13H22F2O3S/c1-9-3-10(2)5-12(6-11(4-9)7-12)8-13(14,15)19(16,17)18/h9-11H,3-8H2,1-2H3,(H,16,17,18) |
| InChIKey | DPUNUBBRFZHJLH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|