C15H22F2O3S — CID 88917244
2-(3-cyclopropyl-1-adamantyl)-1,1-difluoroethanesulfonic acid (PubChem CID 88917244) has the molecular formula C15H22F2O3S and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-(3-cyclopropyl-1-adamantyl)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(3-cyclopropyl-1-adamantyl)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 88917244 |
| Molecular Formula | C15H22F2O3S |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(3-cyclopropyl-1-adamantyl)-1,1-difluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC12CC3CC(C1)CC(C1CC1)(C3)C2 |
| InChI | InChI=1S/C15H22F2O3S/c16-15(17,21(18,19)20)9-13-4-10-3-11(5-13)7-14(6-10,8-13)12-1-2-12/h10-12H,1-9H2,(H,18,19,20) |
| InChIKey | HQJCLKFZHQHSFD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|