C19H20F6O4S2 — CID 123959822
3-[4-(1-adamantyl)phenoxy]sulfanyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 123959822) has the molecular formula C19H20F6O4S2 and a molecular weight of 490.49 g/mol. Its IUPAC name is 3-[4-(1-adamantyl)phenoxy]sulfanyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-(1-adamantyl)phenoxy]sulfanyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123959822 |
| Molecular Formula | C19H20F6O4S2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 3-[4-(1-adamantyl)phenoxy]sulfanyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)SOc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H20F6O4S2/c20-17(21,19(24,25)31(26,27)28)18(22,23)30-29-15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16/h1-4,11-13H,5-10H2,(H,26,27,28) |
| InChIKey | RTKCOXMKRMYTOZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|