About [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate
[4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate (PubChem CID 4043567) has the molecular formula C23H25NO4S
and a molecular weight of 411.52 g/mol. Its IUPAC name is [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate.
Molecular Properties
| Compound Name | [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate |
| PubChem CID | 4043567 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H25NO4S/c25-22(24-29(26,27)21-4-2-1-3-5-21)28-20-8-6-19(7-9-20)23-13-16-10-17(14-23)12-18(11-16)15-23/h1-9,16-18H,10-15H2,(H,24,25) |
| InChIKey | DPVZESXNFMTYAL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate?
The IUPAC name of [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate (CID 4043567) is [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate.
What is the SMILES notation for [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate?
The canonical SMILES for [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate is O=C(NS(=O)(=O)c1ccccc1)Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate?
The InChIKey is DPVZESXNFMTYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO4S/c25-22(24-29(26,27)21-4-2-1-3-5-21)28-20-8-6-19(7-9-20)23-13-16-10-17(14-23)12-18(11-16)15-23/h1-9,16-18H,10-15H2,(H,24,25).
What are the key properties of [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate?
[4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate has a molecular weight of 411.52 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-adamantyl)phenyl] N-(benzenesulfonyl)carbamate is sourced from PubChem (CID 4043567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).