C28H36N2O4 — CID 118586680
[4-(1-adamantylcarbamoyloxy)phenyl] N-(1-adamantyl)carbamate (PubChem CID 118586680) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-(1-adamantylcarbamoyloxy)phenyl] N-(1-adamantyl)carbamate.
| Compound Name | [4-(1-adamantylcarbamoyloxy)phenyl] N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 118586680 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [4-(1-adamantylcarbamoyloxy)phenyl] N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)Oc1ccc(OC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C28H36N2O4/c31-25(29-27-11-17-5-18(12-27)7-19(6-17)13-27)33-23-1-2-24(4-3-23)34-26(32)30-28-14-20-8-21(15-28)10-22(9-20)16-28/h1-4,17-22H,5-16H2,(H,29,31)(H,30,32) |
| InChIKey | CLKMWHLKNZZIEC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |