C17H27NO3 — CID 101421050
[(1R,2S)-2-hydroxycyclohexyl] N-(1-adamantyl)carbamate (PubChem CID 101421050) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclohexyl] N-(1-adamantyl)carbamate.
| Compound Name | [(1R,2S)-2-hydroxycyclohexyl] N-(1-adamantyl)carbamate |
|---|---|
| PubChem CID | 101421050 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclohexyl] N-(1-adamantyl)carbamate |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)O[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H27NO3/c19-14-3-1-2-4-15(14)21-16(20)18-17-8-11-5-12(9-17)7-13(6-11)10-17/h11-15,19H,1-10H2,(H,18,20)/t11?,12?,13?,14-,15+,17?/m0/s1 |
| InChIKey | DUGDYQYHLBZJAS-ULRUDBTPSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |